C21H25N3O4S — CID 9414906
N'-[3-(4-piperidin-1-ylsulfonylphenyl)propanoyl]benzohydrazide (PubChem CID 9414906) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is N'-[3-(4-piperidin-1-ylsulfonylphenyl)propanoyl]benzohydrazide.
| Compound Name | N'-[3-(4-piperidin-1-ylsulfonylphenyl)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 9414906 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | N'-[3-(4-piperidin-1-ylsulfonylphenyl)propanoyl]benzohydrazide |
| SMILES | O=C(CCc1ccc(S(=O)(=O)N2CCCCC2)cc1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H25N3O4S/c25-20(22-23-21(26)18-7-3-1-4-8-18)14-11-17-9-12-19(13-10-17)29(27,28)24-15-5-2-6-16-24/h1,3-4,7-10,12-13H,2,5-6,11,14-16H2,(H,22,25)(H,23,26) |
| InChIKey | WJSVTPYRXZVTKV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|