C23H29N3O4S2 — CID 27684358
N'-[3-[4-(azepan-1-ylsulfonyl)phenyl]propanoyl]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbohydrazide (PubChem CID 27684358) has the molecular formula C23H29N3O4S2 and a molecular weight of 475.64 g/mol. Its IUPAC name is N'-[3-[4-(azepan-1-ylsulfonyl)phenyl]propanoyl]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbohydrazide.
| Compound Name | N'-[3-[4-(azepan-1-ylsulfonyl)phenyl]propanoyl]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 27684358 |
| Molecular Formula | C23H29N3O4S2 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | N'-[3-[4-(azepan-1-ylsulfonyl)phenyl]propanoyl]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbohydrazide |
| SMILES | O=C(CCc1ccc(S(=O)(=O)N2CCCCCC2)cc1)NNC(=O)c1cc2c(s1)CCC2 |
| InChI | InChI=1S/C23H29N3O4S2/c27-22(24-25-23(28)21-16-18-6-5-7-20(18)31-21)13-10-17-8-11-19(12-9-17)32(29,30)26-14-3-1-2-4-15-26/h8-9,11-12,16H,1-7,10,13-15H2,(H,24,27)(H,25,28) |
| InChIKey | VKQAUSPSIVTGMP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|