C15H22N2O2S — CID 31845764
N'-pentanoyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbohydrazide (PubChem CID 31845764) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is N'-pentanoyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbohydrazide.
| Compound Name | N'-pentanoyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 31845764 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N'-pentanoyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbohydrazide |
| SMILES | CCCCC(=O)NNC(=O)c1cc2c(s1)CCCCC2 |
| InChI | InChI=1S/C15H22N2O2S/c1-2-3-9-14(18)16-17-15(19)13-10-11-7-5-4-6-8-12(11)20-13/h10H,2-9H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | HUDVPCMYCPPWDS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|