C20H25N3O3S2 — CID 24643161
N-[4-[2-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)hydrazinyl]-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 24643161) has the molecular formula C20H25N3O3S2 and a molecular weight of 419.57 g/mol. Its IUPAC name is N-[4-[2-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)hydrazinyl]-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[2-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)hydrazinyl]-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 24643161 |
| Molecular Formula | C20H25N3O3S2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | N-[4-[2-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)hydrazinyl]-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | O=C(CCCNC(=O)c1ccsc1)NNC(=O)c1cc2c(s1)CCCCCC2 |
| InChI | InChI=1S/C20H25N3O3S2/c24-18(8-5-10-21-19(25)15-9-11-27-13-15)22-23-20(26)17-12-14-6-3-1-2-4-7-16(14)28-17/h9,11-13H,1-8,10H2,(H,21,25)(H,22,24)(H,23,26) |
| InChIKey | JCEDXZBYIIQSDM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|