C19H27N3O3S — CID 38770118
cis-(1S,2R)-N-[3-[2-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)hydrazinyl]-3-oxopropyl]-2-methylcyclopropane-1-carboxamide (PubChem CID 38770118) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is cis-(1S,2R)-N-[3-[2-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)hydrazinyl]-3-oxopropyl]-2-methylcyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-N-[3-[2-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)hydrazinyl]-3-oxopropyl]-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 38770118 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | cis-(1S,2R)-N-[3-[2-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)hydrazinyl]-3-oxopropyl]-2-methylcyclopropane-1-carboxamide |
| SMILES | C[C@@H]1C[C@@H]1C(=O)NCCC(=O)NNC(=O)c1cc2c(s1)CCCCCC2 |
| InChI | InChI=1S/C19H27N3O3S/c1-12-10-14(12)18(24)20-9-8-17(23)21-22-19(25)16-11-13-6-4-2-3-5-7-15(13)26-16/h11-12,14H,2-10H2,1H3,(H,20,24)(H,21,23)(H,22,25)/t12-,14+/m1/s1 |
| InChIKey | JRQUFBDMLVPQQZ-OCCSQVGLSA-N |
| XLogP | 2.33 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|