C17H27N3OS2 — CID 9149993
1-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonylamino)-3-(3-methylbutyl)thiourea (PubChem CID 9149993) has the molecular formula C17H27N3OS2 and a molecular weight of 353.56 g/mol. Its IUPAC name is 1-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonylamino)-3-(3-methylbutyl)thiourea.
| Compound Name | 1-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonylamino)-3-(3-methylbutyl)thiourea |
|---|---|
| PubChem CID | 9149993 |
| Molecular Formula | C17H27N3OS2 |
| Molecular Weight | 353.56 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 1-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonylamino)-3-(3-methylbutyl)thiourea |
| SMILES | CC(C)CCNC(=S)NNC(=O)c1cc2c(s1)CCCCCC2 |
| InChI | InChI=1S/C17H27N3OS2/c1-12(2)9-10-18-17(22)20-19-16(21)15-11-13-7-5-3-4-6-8-14(13)23-15/h11-12H,3-10H2,1-2H3,(H,19,21)(H2,18,20,22) |
| InChIKey | OWTHNZKXDTVEMU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|