C19H23N3OS2 — CID 27520361
1-[(1S)-1-phenylethyl]-3-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonylamino)thiourea (PubChem CID 27520361) has the molecular formula C19H23N3OS2 and a molecular weight of 373.55 g/mol. Its IUPAC name is 1-[(1S)-1-phenylethyl]-3-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonylamino)thiourea.
| Compound Name | 1-[(1S)-1-phenylethyl]-3-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonylamino)thiourea |
|---|---|
| PubChem CID | 27520361 |
| Molecular Formula | C19H23N3OS2 |
| Molecular Weight | 373.55 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 1-[(1S)-1-phenylethyl]-3-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonylamino)thiourea |
| SMILES | C[C@H](NC(=S)NNC(=O)c1cc2c(s1)CCCCC2)c1ccccc1 |
| InChI | InChI=1S/C19H23N3OS2/c1-13(14-8-4-2-5-9-14)20-19(24)22-21-18(23)17-12-15-10-6-3-7-11-16(15)25-17/h2,4-5,8-9,12-13H,3,6-7,10-11H2,1H3,(H,21,23)(H2,20,22,24)/t13-/m0/s1 |
| InChIKey | FKAOYISZFYQXNA-ZDUSSCGKSA-N |
| XLogP | 3.89 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|