C21H25N3O3S — CID 78804573
N-[4-oxo-4-[2-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)hydrazinyl]butan-2-yl]benzamide (PubChem CID 78804573) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is N-[4-oxo-4-[2-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)hydrazinyl]butan-2-yl]benzamide.
| Compound Name | N-[4-oxo-4-[2-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)hydrazinyl]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 78804573 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N-[4-oxo-4-[2-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)hydrazinyl]butan-2-yl]benzamide |
| SMILES | CC(CC(=O)NNC(=O)c1cc2c(s1)CCCCC2)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H25N3O3S/c1-14(22-20(26)15-8-4-2-5-9-15)12-19(25)23-24-21(27)18-13-16-10-6-3-7-11-17(16)28-18/h2,4-5,8-9,13-14H,3,6-7,10-12H2,1H3,(H,22,26)(H,23,25)(H,24,27) |
| InChIKey | NKFDEJZMOQDLOY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|