C19H23N3OS2 — CID 8001025
1-(3,5-dimethylphenyl)-3-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonylamino)thiourea (PubChem CID 8001025) has the molecular formula C19H23N3OS2 and a molecular weight of 373.55 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonylamino)thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonylamino)thiourea |
|---|---|
| PubChem CID | 8001025 |
| Molecular Formula | C19H23N3OS2 |
| Molecular Weight | 373.55 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonylamino)thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)NNC(=O)c2cc3c(s2)CCCCC3)c1 |
| InChI | InChI=1S/C19H23N3OS2/c1-12-8-13(2)10-15(9-12)20-19(24)22-21-18(23)17-11-14-6-4-3-5-7-16(14)25-17/h8-11H,3-7H2,1-2H3,(H,21,23)(H2,20,22,24) |
| InChIKey | LKJIAYWUYXEFGU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|