C17H19N3O2S — CID 17268199
1-(4-methylphenyl)-3-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonylamino)urea (PubChem CID 17268199) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonylamino)urea.
| Compound Name | 1-(4-methylphenyl)-3-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonylamino)urea |
|---|---|
| PubChem CID | 17268199 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 1-(4-methylphenyl)-3-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonylamino)urea |
| SMILES | Cc1ccc(NC(=O)NNC(=O)c2cc3c(s2)CCCC3)cc1 |
| InChI | InChI=1S/C17H19N3O2S/c1-11-6-8-13(9-7-11)18-17(22)20-19-16(21)15-10-12-4-2-3-5-14(12)23-15/h6-10H,2-5H2,1H3,(H,19,21)(H2,18,20,22) |
| InChIKey | BGBACCBKYPGYCQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|