C23H23N3O4S2 — CID 24634813
3-[(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)carbamoyl]-4-methyl-N-(4-methylphenyl)benzenesulfonamide (PubChem CID 24634813) has the molecular formula C23H23N3O4S2 and a molecular weight of 469.59 g/mol. Its IUPAC name is 3-[(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)carbamoyl]-4-methyl-N-(4-methylphenyl)benzenesulfonamide.
| Compound Name | 3-[(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)carbamoyl]-4-methyl-N-(4-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 24634813 |
| Molecular Formula | C23H23N3O4S2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 3-[(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)carbamoyl]-4-methyl-N-(4-methylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(C)c(C(=O)NNC(=O)c3cc4c(s3)CCC4)c2)cc1 |
| InChI | InChI=1S/C23H23N3O4S2/c1-14-6-9-17(10-7-14)26-32(29,30)18-11-8-15(2)19(13-18)22(27)24-25-23(28)21-12-16-4-3-5-20(16)31-21/h6-13,26H,3-5H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | HQIUZYHOTOCWNG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|