C16H17N3O4S2 — CID 27684841
3-[(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)carbamoyl]-N-methylbenzenesulfonamide (PubChem CID 27684841) has the molecular formula C16H17N3O4S2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 3-[(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)carbamoyl]-N-methylbenzenesulfonamide.
| Compound Name | 3-[(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)carbamoyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 27684841 |
| Molecular Formula | C16H17N3O4S2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 3-[(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)carbamoyl]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)NNC(=O)c2cc3c(s2)CCC3)c1 |
| InChI | InChI=1S/C16H17N3O4S2/c1-17-25(22,23)12-6-2-5-11(8-12)15(20)18-19-16(21)14-9-10-4-3-7-13(10)24-14/h2,5-6,8-9,17H,3-4,7H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | FYJBGRQAITVNTN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|