C16H19N3O4S2 — CID 4793839
3-[[(5-ethyl-4-methylthiophene-2-carbonyl)amino]carbamoyl]-N-methylbenzenesulfonamide (PubChem CID 4793839) has the molecular formula C16H19N3O4S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 3-[[(5-ethyl-4-methylthiophene-2-carbonyl)amino]carbamoyl]-N-methylbenzenesulfonamide.
| Compound Name | 3-[[(5-ethyl-4-methylthiophene-2-carbonyl)amino]carbamoyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 4793839 |
| Molecular Formula | C16H19N3O4S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 3-[[(5-ethyl-4-methylthiophene-2-carbonyl)amino]carbamoyl]-N-methylbenzenesulfonamide |
| SMILES | CCc1sc(C(=O)NNC(=O)c2cccc(S(=O)(=O)NC)c2)cc1C |
| InChI | InChI=1S/C16H19N3O4S2/c1-4-13-10(2)8-14(24-13)16(21)19-18-15(20)11-6-5-7-12(9-11)25(22,23)17-3/h5-9,17H,4H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | FKDJMNAIJCIWFE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|