C16H20N2O3S2 — CID 55656221
5-ethyl-4-methyl-N-[[3-(methylsulfamoyl)phenyl]methyl]thiophene-2-carboxamide (PubChem CID 55656221) has the molecular formula C16H20N2O3S2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 5-ethyl-4-methyl-N-[[3-(methylsulfamoyl)phenyl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-ethyl-4-methyl-N-[[3-(methylsulfamoyl)phenyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55656221 |
| Molecular Formula | C16H20N2O3S2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 5-ethyl-4-methyl-N-[[3-(methylsulfamoyl)phenyl]methyl]thiophene-2-carboxamide |
| SMILES | CCc1sc(C(=O)NCc2cccc(S(=O)(=O)NC)c2)cc1C |
| InChI | InChI=1S/C16H20N2O3S2/c1-4-14-11(2)8-15(22-14)16(19)18-10-12-6-5-7-13(9-12)23(20,21)17-3/h5-9,17H,4,10H2,1-3H3,(H,18,19) |
| InChIKey | DUSKVQQOAYNAHG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |