C15H17N3O4S2 — CID 17463497
N,N-dimethyl-3-[[(5-methylthiophene-2-carbonyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 17463497) has the molecular formula C15H17N3O4S2 and a molecular weight of 367.45 g/mol. Its IUPAC name is N,N-dimethyl-3-[[(5-methylthiophene-2-carbonyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-3-[[(5-methylthiophene-2-carbonyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 17463497 |
| Molecular Formula | C15H17N3O4S2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | N,N-dimethyl-3-[[(5-methylthiophene-2-carbonyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | Cc1ccc(C(=O)NNC(=O)c2cccc(S(=O)(=O)N(C)C)c2)s1 |
| InChI | InChI=1S/C15H17N3O4S2/c1-10-7-8-13(23-10)15(20)17-16-14(19)11-5-4-6-12(9-11)24(21,22)18(2)3/h4-9H,1-3H3,(H,16,19)(H,17,20) |
| InChIKey | NBQUNQXZIQIYRY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|