C13H19N3O4S2 — CID 24639201
N,N-dimethyl-3-[(3-methylsulfanylpropanoylamino)carbamoyl]benzenesulfonamide (PubChem CID 24639201) has the molecular formula C13H19N3O4S2 and a molecular weight of 345.45 g/mol. Its IUPAC name is N,N-dimethyl-3-[(3-methylsulfanylpropanoylamino)carbamoyl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-3-[(3-methylsulfanylpropanoylamino)carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24639201 |
| Molecular Formula | C13H19N3O4S2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | N,N-dimethyl-3-[(3-methylsulfanylpropanoylamino)carbamoyl]benzenesulfonamide |
| SMILES | CSCCC(=O)NNC(=O)c1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C13H19N3O4S2/c1-16(2)22(19,20)11-6-4-5-10(9-11)13(18)15-14-12(17)7-8-21-3/h4-6,9H,7-8H2,1-3H3,(H,14,17)(H,15,18) |
| InChIKey | FQLWVDBNHZAIAX-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|