C22H25N5O5S — CID 56513417
N-(2-cyanoethyl)-4-[2-[3-(dimethylsulfamoyl)benzoyl]hydrazinyl]-4-oxo-N-phenylbutanamide (PubChem CID 56513417) has the molecular formula C22H25N5O5S and a molecular weight of 471.54 g/mol. Its IUPAC name is N-(2-cyanoethyl)-4-[2-[3-(dimethylsulfamoyl)benzoyl]hydrazinyl]-4-oxo-N-phenylbutanamide.
| Compound Name | N-(2-cyanoethyl)-4-[2-[3-(dimethylsulfamoyl)benzoyl]hydrazinyl]-4-oxo-N-phenylbutanamide |
|---|---|
| PubChem CID | 56513417 |
| Molecular Formula | C22H25N5O5S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | N-(2-cyanoethyl)-4-[2-[3-(dimethylsulfamoyl)benzoyl]hydrazinyl]-4-oxo-N-phenylbutanamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)NNC(=O)CCC(=O)N(CCC#N)c2ccccc2)c1 |
| InChI | InChI=1S/C22H25N5O5S/c1-26(2)33(31,32)19-11-6-8-17(16-19)22(30)25-24-20(28)12-13-21(29)27(15-7-14-23)18-9-4-3-5-10-18/h3-6,8-11,16H,7,12-13,15H2,1-2H3,(H,24,28)(H,25,30) |
| InChIKey | WEIADKKIJOBQAA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 139.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|