C17H19N3O5S2 — CID 9473120
N,N-dimethyl-3-[[(4-oxo-4-thiophen-2-ylbutanoyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 9473120) has the molecular formula C17H19N3O5S2 and a molecular weight of 409.49 g/mol. Its IUPAC name is N,N-dimethyl-3-[[(4-oxo-4-thiophen-2-ylbutanoyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-3-[[(4-oxo-4-thiophen-2-ylbutanoyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 9473120 |
| Molecular Formula | C17H19N3O5S2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | N,N-dimethyl-3-[[(4-oxo-4-thiophen-2-ylbutanoyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)NNC(=O)CCC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C17H19N3O5S2/c1-20(2)27(24,25)13-6-3-5-12(11-13)17(23)19-18-16(22)9-8-14(21)15-7-4-10-26-15/h3-7,10-11H,8-9H2,1-2H3,(H,18,22)(H,19,23) |
| InChIKey | IDHMLKVNIHLOAZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|