C17H18FN3O5S — CID 8880057
3-[[[2-(4-fluorophenoxy)acetyl]amino]carbamoyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 8880057) has the molecular formula C17H18FN3O5S and a molecular weight of 395.41 g/mol. Its IUPAC name is 3-[[[2-(4-fluorophenoxy)acetyl]amino]carbamoyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-[[[2-(4-fluorophenoxy)acetyl]amino]carbamoyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 8880057 |
| Molecular Formula | C17H18FN3O5S |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 3-[[[2-(4-fluorophenoxy)acetyl]amino]carbamoyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)NNC(=O)COc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H18FN3O5S/c1-21(2)27(24,25)15-5-3-4-12(10-15)17(23)20-19-16(22)11-26-14-8-6-13(18)7-9-14/h3-10H,11H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | UYICOLPESYLXOU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|