C18H18F3N3O5S — CID 2548184
N,N-dimethyl-4-[[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]carbamoyl]benzenesulfonamide (PubChem CID 2548184) has the molecular formula C18H18F3N3O5S and a molecular weight of 445.42 g/mol. Its IUPAC name is N,N-dimethyl-4-[[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]carbamoyl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-4-[[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2548184 |
| Molecular Formula | C18H18F3N3O5S |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | N,N-dimethyl-4-[[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]carbamoyl]benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)NNC(=O)COc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H18F3N3O5S/c1-24(2)30(27,28)15-8-6-12(7-9-15)17(26)23-22-16(25)11-29-14-5-3-4-13(10-14)18(19,20)21/h3-10H,11H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | HKCYDKWBLHEVFI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|