C20H16F3N3O3 — CID 60605892
3-pyrrol-1-yl-N'-[2-[3-(trifluoromethyl)phenoxy]acetyl]benzohydrazide (PubChem CID 60605892) has the molecular formula C20H16F3N3O3 and a molecular weight of 403.36 g/mol. Its IUPAC name is 3-pyrrol-1-yl-N'-[2-[3-(trifluoromethyl)phenoxy]acetyl]benzohydrazide.
| Compound Name | 3-pyrrol-1-yl-N'-[2-[3-(trifluoromethyl)phenoxy]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 60605892 |
| Molecular Formula | C20H16F3N3O3 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 3-pyrrol-1-yl-N'-[2-[3-(trifluoromethyl)phenoxy]acetyl]benzohydrazide |
| SMILES | O=C(COc1cccc(C(F)(F)F)c1)NNC(=O)c1cccc(-n2cccc2)c1 |
| InChI | InChI=1S/C20H16F3N3O3/c21-20(22,23)15-6-4-8-17(12-15)29-13-18(27)24-25-19(28)14-5-3-7-16(11-14)26-9-1-2-10-26/h1-12H,13H2,(H,24,27)(H,25,28) |
| InChIKey | JJUWJMZILJPTPL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|