C18H15F4N3O4 — CID 18228275
2-fluoro-N-[2-oxo-2-[2-[2-[3-(trifluoromethyl)phenoxy]acetyl]hydrazinyl]ethyl]benzamide (PubChem CID 18228275) has the molecular formula C18H15F4N3O4 and a molecular weight of 413.33 g/mol. Its IUPAC name is 2-fluoro-N-[2-oxo-2-[2-[2-[3-(trifluoromethyl)phenoxy]acetyl]hydrazinyl]ethyl]benzamide.
| Compound Name | 2-fluoro-N-[2-oxo-2-[2-[2-[3-(trifluoromethyl)phenoxy]acetyl]hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 18228275 |
| Molecular Formula | C18H15F4N3O4 |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 2-fluoro-N-[2-oxo-2-[2-[2-[3-(trifluoromethyl)phenoxy]acetyl]hydrazinyl]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1F)NNC(=O)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H15F4N3O4/c19-14-7-2-1-6-13(14)17(28)23-9-15(26)24-25-16(27)10-29-12-5-3-4-11(8-12)18(20,21)22/h1-8H,9-10H2,(H,23,28)(H,24,26)(H,25,27) |
| InChIKey | FUDQPSUPAYBXRX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|