C17H16FN3O3 — CID 24637562
2-fluoro-N-[2-oxo-2-[2-(2-phenylacetyl)hydrazinyl]ethyl]benzamide (PubChem CID 24637562) has the molecular formula C17H16FN3O3 and a molecular weight of 329.33 g/mol. Its IUPAC name is 2-fluoro-N-[2-oxo-2-[2-(2-phenylacetyl)hydrazinyl]ethyl]benzamide.
| Compound Name | 2-fluoro-N-[2-oxo-2-[2-(2-phenylacetyl)hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 24637562 |
| Molecular Formula | C17H16FN3O3 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2-fluoro-N-[2-oxo-2-[2-(2-phenylacetyl)hydrazinyl]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1F)NNC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C17H16FN3O3/c18-14-9-5-4-8-13(14)17(24)19-11-16(23)21-20-15(22)10-12-6-2-1-3-7-12/h1-9H,10-11H2,(H,19,24)(H,20,22)(H,21,23) |
| InChIKey | PZPYOGBEGHIWAO-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|