C12H11FN2O2 — CID 18110116
2-fluoro-N-[2-oxo-2-(prop-2-ynylamino)ethyl]benzamide (PubChem CID 18110116) has the molecular formula C12H11FN2O2 and a molecular weight of 234.23 g/mol. Its IUPAC name is 2-fluoro-N-[2-oxo-2-(prop-2-ynylamino)ethyl]benzamide.
| Compound Name | 2-fluoro-N-[2-oxo-2-(prop-2-ynylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 18110116 |
| Molecular Formula | C12H11FN2O2 |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2-fluoro-N-[2-oxo-2-(prop-2-ynylamino)ethyl]benzamide |
| SMILES | C#CCNC(=O)CNC(=O)c1ccccc1F |
| InChI | InChI=1S/C12H11FN2O2/c1-2-7-14-11(16)8-15-12(17)9-5-3-4-6-10(9)13/h1,3-6H,7-8H2,(H,14,16)(H,15,17) |
| InChIKey | GQAVGCQGQVIZHK-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|