C22H18F3NO2 — CID 100758154
N-benzhydryl-2-[3-(trifluoromethyl)phenoxy]acetamide (PubChem CID 100758154) has the molecular formula C22H18F3NO2 and a molecular weight of 385.39 g/mol. Its IUPAC name is N-benzhydryl-2-[3-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-benzhydryl-2-[3-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 100758154 |
| Molecular Formula | C22H18F3NO2 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | N-benzhydryl-2-[3-(trifluoromethyl)phenoxy]acetamide |
| SMILES | O=C(COc1cccc(C(F)(F)F)c1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H18F3NO2/c23-22(24,25)18-12-7-13-19(14-18)28-15-20(27)26-21(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-14,21H,15H2,(H,26,27) |
| InChIKey | LQFJKNIYRQCUSV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |