C25H21F3N2O2 — CID 121131563
1-benzhydryl-3-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]urea (PubChem CID 121131563) has the molecular formula C25H21F3N2O2 and a molecular weight of 438.45 g/mol. Its IUPAC name is 1-benzhydryl-3-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]urea.
| Compound Name | 1-benzhydryl-3-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]urea |
|---|---|
| PubChem CID | 121131563 |
| Molecular Formula | C25H21F3N2O2 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 1-benzhydryl-3-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]urea |
| SMILES | O=C(NCC#CCOc1cccc(C(F)(F)F)c1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H21F3N2O2/c26-25(27,28)21-14-9-15-22(18-21)32-17-8-7-16-29-24(31)30-23(19-10-3-1-4-11-19)20-12-5-2-6-13-20/h1-6,9-15,18,23H,16-17H2,(H2,29,30,31) |
| InChIKey | UBEWBNMKRJFSKG-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|