C20H12F9NO2 — CID 121131554
3,5-bis(trifluoromethyl)-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]benzamide (PubChem CID 121131554) has the molecular formula C20H12F9NO2 and a molecular weight of 469.30 g/mol. Its IUPAC name is 3,5-bis(trifluoromethyl)-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]benzamide.
| Compound Name | 3,5-bis(trifluoromethyl)-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]benzamide |
|---|---|
| PubChem CID | 121131554 |
| Molecular Formula | C20H12F9NO2 |
| Molecular Weight | 469.30 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | 3,5-bis(trifluoromethyl)-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]benzamide |
| SMILES | O=C(NCC#CCOc1cccc(C(F)(F)F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H12F9NO2/c21-18(22,23)13-4-3-5-16(11-13)32-7-2-1-6-30-17(31)12-8-14(19(24,25)26)10-15(9-12)20(27,28)29/h3-5,8-11H,6-7H2,(H,30,31) |
| InChIKey | XMPFTEUXVBUXPR-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.30 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|