C19H13F6NO2 — CID 90575873
4-(trifluoromethyl)-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]benzamide (PubChem CID 90575873) has the molecular formula C19H13F6NO2 and a molecular weight of 401.31 g/mol. Its IUPAC name is 4-(trifluoromethyl)-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]benzamide.
| Compound Name | 4-(trifluoromethyl)-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]benzamide |
|---|---|
| PubChem CID | 90575873 |
| Molecular Formula | C19H13F6NO2 |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 4-(trifluoromethyl)-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]benzamide |
| SMILES | O=C(NCC#CCOc1cccc(C(F)(F)F)c1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H13F6NO2/c20-18(21,22)14-8-6-13(7-9-14)17(27)26-10-1-2-11-28-16-5-3-4-15(12-16)19(23,24)25/h3-9,12H,10-11H2,(H,26,27) |
| InChIKey | WIMSWSDXDBHKOG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|