C23H23F3N2O4S — CID 90575908
4-piperidin-1-ylsulfonyl-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]benzamide (PubChem CID 90575908) has the molecular formula C23H23F3N2O4S and a molecular weight of 480.51 g/mol. Its IUPAC name is 4-piperidin-1-ylsulfonyl-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]benzamide.
| Compound Name | 4-piperidin-1-ylsulfonyl-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]benzamide |
|---|---|
| PubChem CID | 90575908 |
| Molecular Formula | C23H23F3N2O4S |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 4-piperidin-1-ylsulfonyl-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]benzamide |
| SMILES | O=C(NCC#CCOc1cccc(C(F)(F)F)c1)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C23H23F3N2O4S/c24-23(25,26)19-7-6-8-20(17-19)32-16-5-2-13-27-22(29)18-9-11-21(12-10-18)33(30,31)28-14-3-1-4-15-28/h6-12,17H,1,3-4,13-16H2,(H,27,29) |
| InChIKey | CKBBFVRRFNGSIO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|