C20H21F3N2O5S — CID 100758065
N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)-2-[3-(trifluoromethyl)phenoxy]acetamide (PubChem CID 100758065) has the molecular formula C20H21F3N2O5S and a molecular weight of 458.46 g/mol. Its IUPAC name is N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)-2-[3-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)-2-[3-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 100758065 |
| Molecular Formula | C20H21F3N2O5S |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)-2-[3-(trifluoromethyl)phenoxy]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC2)cc1NC(=O)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H21F3N2O5S/c1-29-18-8-7-16(31(27,28)25-9-2-3-10-25)12-17(18)24-19(26)13-30-15-6-4-5-14(11-15)20(21,22)23/h4-8,11-12H,2-3,9-10,13H2,1H3,(H,24,26) |
| InChIKey | CDDUAOKRJWQIEV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |