C24H26N2O7S — CID 16547871
N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide (PubChem CID 16547871) has the molecular formula C24H26N2O7S and a molecular weight of 486.55 g/mol. Its IUPAC name is N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 16547871 |
| Molecular Formula | C24H26N2O7S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=O)COc1ccc2c(C)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H26N2O7S/c1-16-12-24(28)33-22-13-17(6-8-19(16)22)32-15-23(27)25-20-14-18(7-9-21(20)31-2)34(29,30)26-10-4-3-5-11-26/h6-9,12-14H,3-5,10-11,15H2,1-2H3,(H,25,27) |
| InChIKey | JVMNVMWLVXYGME-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|