C22H21NO8 — CID 23736109
[2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-(4-methyl-2-oxochromen-7-yl)oxyacetate (PubChem CID 23736109) has the molecular formula C22H21NO8 and a molecular weight of 427.41 g/mol. Its IUPAC name is [2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-(4-methyl-2-oxochromen-7-yl)oxyacetate.
| Compound Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-(4-methyl-2-oxochromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 23736109 |
| Molecular Formula | C22H21NO8 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-(4-methyl-2-oxochromen-7-yl)oxyacetate |
| SMILES | COc1ccc(OC)c(NC(=O)COC(=O)COc2ccc3c(C)cc(=O)oc3c2)c1 |
| InChI | InChI=1S/C22H21NO8/c1-13-8-21(25)31-19-10-15(4-6-16(13)19)29-12-22(26)30-11-20(24)23-17-9-14(27-2)5-7-18(17)28-3/h4-10H,11-12H2,1-3H3,(H,23,24) |
| InChIKey | YHKCMUWNBQPVPN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|