C21H25NO6 — CID 8597894
[2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-(4-propan-2-ylphenoxy)acetate (PubChem CID 8597894) has the molecular formula C21H25NO6 and a molecular weight of 387.43 g/mol. Its IUPAC name is [2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-(4-propan-2-ylphenoxy)acetate.
| Compound Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-(4-propan-2-ylphenoxy)acetate |
|---|---|
| PubChem CID | 8597894 |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-(4-propan-2-ylphenoxy)acetate |
| SMILES | COc1ccc(OC)c(NC(=O)COC(=O)COc2ccc(C(C)C)cc2)c1 |
| InChI | InChI=1S/C21H25NO6/c1-14(2)15-5-7-16(8-6-15)27-13-21(24)28-12-20(23)22-18-11-17(25-3)9-10-19(18)26-4/h5-11,14H,12-13H2,1-4H3,(H,22,23) |
| InChIKey | KPZODCNLDNZHBT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |