C13H17NO5 — CID 2086138
[2-(2,5-dimethoxyanilino)-2-oxoethyl] propanoate (PubChem CID 2086138) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is [2-(2,5-dimethoxyanilino)-2-oxoethyl] propanoate.
| Compound Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] propanoate |
|---|---|
| PubChem CID | 2086138 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] propanoate |
| SMILES | CCC(=O)OCC(=O)Nc1cc(OC)ccc1OC |
| InChI | InChI=1S/C13H17NO5/c1-4-13(16)19-8-12(15)14-10-7-9(17-2)5-6-11(10)18-3/h5-7H,4,8H2,1-3H3,(H,14,15) |
| InChIKey | VGCDNBUMZFVMSV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |