C17H23NO5 — CID 2391445
[2-(2,5-dimethoxyanilino)-2-oxoethyl] cyclohexanecarboxylate (PubChem CID 2391445) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is [2-(2,5-dimethoxyanilino)-2-oxoethyl] cyclohexanecarboxylate.
| Compound Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 2391445 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] cyclohexanecarboxylate |
| SMILES | COc1ccc(OC)c(NC(=O)COC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C17H23NO5/c1-21-13-8-9-15(22-2)14(10-13)18-16(19)11-23-17(20)12-6-4-3-5-7-12/h8-10,12H,3-7,11H2,1-2H3,(H,18,19) |
| InChIKey | FSAFCNCPDZVPEX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |