C17H21NO5 — CID 9065392
[2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate (PubChem CID 9065392) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is [2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate.
| Compound Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 9065392 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate |
| SMILES | COc1ccc(OC)c(NC(=O)COC(=O)C[C@H]2C=CCC2)c1 |
| InChI | InChI=1S/C17H21NO5/c1-21-13-7-8-15(22-2)14(10-13)18-16(19)11-23-17(20)9-12-5-3-4-6-12/h3,5,7-8,10,12H,4,6,9,11H2,1-2H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | RTDRUQFISAUJSQ-LBPRGKRZSA-N |
| XLogP | 2.54 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|