C16H18INO3 — CID 9065495
[2-(4-iodo-2-methylanilino)-2-oxoethyl] 2-[(1R)-cyclopent-2-en-1-yl]acetate (PubChem CID 9065495) has the molecular formula C16H18INO3 and a molecular weight of 399.23 g/mol. Its IUPAC name is [2-(4-iodo-2-methylanilino)-2-oxoethyl] 2-[(1R)-cyclopent-2-en-1-yl]acetate.
| Compound Name | [2-(4-iodo-2-methylanilino)-2-oxoethyl] 2-[(1R)-cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 9065495 |
| Molecular Formula | C16H18INO3 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | [2-(4-iodo-2-methylanilino)-2-oxoethyl] 2-[(1R)-cyclopent-2-en-1-yl]acetate |
| SMILES | Cc1cc(I)ccc1NC(=O)COC(=O)C[C@@H]1C=CCC1 |
| InChI | InChI=1S/C16H18INO3/c1-11-8-13(17)6-7-14(11)18-15(19)10-21-16(20)9-12-4-2-3-5-12/h2,4,6-8,12H,3,5,9-10H2,1H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | LRDSRYFFXBQTSK-GFCCVEGCSA-N |
| XLogP | 3.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|