C15H15Cl2NO3 — CID 9065484
[2-(2,3-dichloroanilino)-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate (PubChem CID 9065484) has the molecular formula C15H15Cl2NO3 and a molecular weight of 328.20 g/mol. Its IUPAC name is [2-(2,3-dichloroanilino)-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate.
| Compound Name | [2-(2,3-dichloroanilino)-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 9065484 |
| Molecular Formula | C15H15Cl2NO3 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | [2-(2,3-dichloroanilino)-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate |
| SMILES | O=C(COC(=O)C[C@H]1C=CCC1)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H15Cl2NO3/c16-11-6-3-7-12(15(11)17)18-13(19)9-21-14(20)8-10-4-1-2-5-10/h1,3-4,6-7,10H,2,5,8-9H2,(H,18,19)/t10-/m0/s1 |
| InChIKey | VHVHQKSCZOJMAW-JTQLQIEISA-N |
| XLogP | 3.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|