C16H15ClN2O3 — CID 9065408
[2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate (PubChem CID 9065408) has the molecular formula C16H15ClN2O3 and a molecular weight of 318.76 g/mol. Its IUPAC name is [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate.
| Compound Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 9065408 |
| Molecular Formula | C16H15ClN2O3 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate |
| SMILES | N#Cc1ccc(Cl)cc1NC(=O)COC(=O)C[C@H]1C=CCC1 |
| InChI | InChI=1S/C16H15ClN2O3/c17-13-6-5-12(9-18)14(8-13)19-15(20)10-22-16(21)7-11-3-1-2-4-11/h1,3,5-6,8,11H,2,4,7,10H2,(H,19,20)/t11-/m0/s1 |
| InChIKey | DLQNUITUJHDCTD-NSHDSACASA-N |
| XLogP | 3.05 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|