C15H16ClNO3 — CID 9065493
[2-(4-chloroanilino)-2-oxoethyl] 2-[(1R)-cyclopent-2-en-1-yl]acetate (PubChem CID 9065493) has the molecular formula C15H16ClNO3 and a molecular weight of 293.75 g/mol. Its IUPAC name is [2-(4-chloroanilino)-2-oxoethyl] 2-[(1R)-cyclopent-2-en-1-yl]acetate.
| Compound Name | [2-(4-chloroanilino)-2-oxoethyl] 2-[(1R)-cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 9065493 |
| Molecular Formula | C15H16ClNO3 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | [2-(4-chloroanilino)-2-oxoethyl] 2-[(1R)-cyclopent-2-en-1-yl]acetate |
| SMILES | O=C(COC(=O)C[C@@H]1C=CCC1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H16ClNO3/c16-12-5-7-13(8-6-12)17-14(18)10-20-15(19)9-11-3-1-2-4-11/h1,3,5-8,11H,2,4,9-10H2,(H,17,18)/t11-/m1/s1 |
| InChIKey | HBTIDSAFGSZREC-LLVKDONJSA-N |
| XLogP | 3.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|