C16H15ClF3NO3 — CID 9065446
[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate (PubChem CID 9065446) has the molecular formula C16H15ClF3NO3 and a molecular weight of 361.75 g/mol. Its IUPAC name is [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate.
| Compound Name | [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 9065446 |
| Molecular Formula | C16H15ClF3NO3 |
| Molecular Weight | 361.75 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate |
| SMILES | O=C(COC(=O)C[C@H]1C=CCC1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H15ClF3NO3/c17-13-6-5-11(8-12(13)16(18,19)20)21-14(22)9-24-15(23)7-10-3-1-2-4-10/h1,3,5-6,8,10H,2,4,7,9H2,(H,21,22)/t10-/m0/s1 |
| InChIKey | XBHLWHJRVQOTCJ-JTQLQIEISA-N |
| XLogP | 4.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.75 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|