C19H18ClF3N2O5 — CID 51517726
[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate (PubChem CID 51517726) has the molecular formula C19H18ClF3N2O5 and a molecular weight of 446.81 g/mol. Its IUPAC name is [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate.
| Compound Name | [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate |
|---|---|
| PubChem CID | 51517726 |
| Molecular Formula | C19H18ClF3N2O5 |
| Molecular Weight | 446.81 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate |
| SMILES | O=C(COC(=O)CN1C(=O)[C@@H]2CCCC[C@H]2C1=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H18ClF3N2O5/c20-14-6-5-10(7-13(14)19(21,22)23)24-15(26)9-30-16(27)8-25-17(28)11-3-1-2-4-12(11)18(25)29/h5-7,11-12H,1-4,8-9H2,(H,24,26)/t11-,12-/m1/s1 |
| InChIKey | HBOSYNKUTFAHBA-VXGBXAGGSA-N |
| XLogP | 3.02 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.81 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|