C12H11ClF3NO4 — CID 8018923
[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 2-methoxyacetate (PubChem CID 8018923) has the molecular formula C12H11ClF3NO4 and a molecular weight of 325.67 g/mol. Its IUPAC name is [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 2-methoxyacetate.
| Compound Name | [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 2-methoxyacetate |
|---|---|
| PubChem CID | 8018923 |
| Molecular Formula | C12H11ClF3NO4 |
| Molecular Weight | 325.67 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 2-methoxyacetate |
| SMILES | COCC(=O)OCC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11ClF3NO4/c1-20-6-11(19)21-5-10(18)17-7-2-3-9(13)8(4-7)12(14,15)16/h2-4H,5-6H2,1H3,(H,17,18) |
| InChIKey | JWCXVUXRTHHAQF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.67 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |