C13H15ClF3NO — CID 803107
N-[4-chloro-3-(trifluoromethyl)phenyl]-3,3-dimethylbutanamide (PubChem CID 803107) has the molecular formula C13H15ClF3NO and a molecular weight of 293.72 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-3,3-dimethylbutanamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 803107 |
| Molecular Formula | C13H15ClF3NO |
| Molecular Weight | 293.72 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15ClF3NO/c1-12(2,3)7-11(19)18-8-4-5-10(14)9(6-8)13(15,16)17/h4-6H,7H2,1-3H3,(H,18,19) |
| InChIKey | HEFUWAMZDWJUNT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.72 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |