C11H12Cl2F3NO — CID 142867328
2-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide;ethane (PubChem CID 142867328) has the molecular formula C11H12Cl2F3NO and a molecular weight of 302.12 g/mol. Its IUPAC name is 2-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide;ethane.
| Compound Name | 2-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide;ethane |
|---|---|
| PubChem CID | 142867328 |
| Molecular Formula | C11H12Cl2F3NO |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 2-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide;ethane |
| SMILES | CC.O=C(CCl)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H6Cl2F3NO.C2H6/c10-4-8(16)15-5-1-2-7(11)6(3-5)9(12,13)14;1-2/h1-3H,4H2,(H,15,16);1-2H3 |
| InChIKey | GNYYKZQEEFVEQZ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|