C13H11ClF3NO — CID 2287537
N-[4-chloro-3-(trifluoromethyl)phenyl]hex-4-ynamide (PubChem CID 2287537) has the molecular formula C13H11ClF3NO and a molecular weight of 289.68 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]hex-4-ynamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]hex-4-ynamide |
|---|---|
| PubChem CID | 2287537 |
| Molecular Formula | C13H11ClF3NO |
| Molecular Weight | 289.68 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]hex-4-ynamide |
| SMILES | CC#CCCC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H11ClF3NO/c1-2-3-4-5-12(19)18-9-6-7-11(14)10(8-9)13(15,16)17/h6-8H,4-5H2,1H3,(H,18,19) |
| InChIKey | VXZCYRNITHSPIO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.68 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|