C20H20ClF3N4O4 — CID 166633079
N-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]-N'-hydroxyhexanediamide (PubChem CID 166633079) has the molecular formula C20H20ClF3N4O4 and a molecular weight of 472.85 g/mol. Its IUPAC name is N-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]-N'-hydroxyhexanediamide.
| Compound Name | N-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]-N'-hydroxyhexanediamide |
|---|---|
| PubChem CID | 166633079 |
| Molecular Formula | C20H20ClF3N4O4 |
| Molecular Weight | 472.85 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | N-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]-N'-hydroxyhexanediamide |
| SMILES | O=C(CCCCC(=O)Nc1ccc(NC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)cc1)NO |
| InChI | InChI=1S/C20H20ClF3N4O4/c21-16-10-9-14(11-15(16)20(22,23)24)27-19(31)26-13-7-5-12(6-8-13)25-17(29)3-1-2-4-18(30)28-32/h5-11,32H,1-4H2,(H,25,29)(H,28,30)(H2,26,27,31) |
| InChIKey | RMNJLLGRLDFYJM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.85 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|