C14H10ClF3N2O3 — CID 108895420
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(3,5-dihydroxyphenyl)urea (PubChem CID 108895420) has the molecular formula C14H10ClF3N2O3 and a molecular weight of 346.69 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(3,5-dihydroxyphenyl)urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(3,5-dihydroxyphenyl)urea |
|---|---|
| PubChem CID | 108895420 |
| Molecular Formula | C14H10ClF3N2O3 |
| Molecular Weight | 346.69 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(3,5-dihydroxyphenyl)urea |
| SMILES | O=C(Nc1cc(O)cc(O)c1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H10ClF3N2O3/c15-12-2-1-7(5-11(12)14(16,17)18)19-13(23)20-8-3-9(21)6-10(22)4-8/h1-6,21-22H,(H2,19,20,23) |
| InChIKey | KMMNWHLRMHWDSV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.69 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |