C15H11Cl2F3N2O — CID 98000868
1-(5-chloro-2-methylphenyl)-3-[4-chloro-3-(trifluoromethyl)phenyl]urea (PubChem CID 98000868) has the molecular formula C15H11Cl2F3N2O and a molecular weight of 363.17 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-3-[4-chloro-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(5-chloro-2-methylphenyl)-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 98000868 |
| Molecular Formula | C15H11Cl2F3N2O |
| Molecular Weight | 363.17 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1ccc(Cl)cc1NC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H11Cl2F3N2O/c1-8-2-3-9(16)6-13(8)22-14(23)21-10-4-5-12(17)11(7-10)15(18,19)20/h2-7H,1H3,(H2,21,22,23) |
| InChIKey | MZJWABPYVGNEDY-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.17 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |