C14H9ClF4N2O2 — CID 53465158
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(2-fluoro-4-hydroxyphenyl)urea (PubChem CID 53465158) has the molecular formula C14H9ClF4N2O2 and a molecular weight of 348.68 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(2-fluoro-4-hydroxyphenyl)urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(2-fluoro-4-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 53465158 |
| Molecular Formula | C14H9ClF4N2O2 |
| Molecular Weight | 348.68 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(2-fluoro-4-hydroxyphenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)Nc1ccc(O)cc1F |
| InChI | InChI=1S/C14H9ClF4N2O2/c15-10-3-1-7(5-9(10)14(17,18)19)20-13(23)21-12-4-2-8(22)6-11(12)16/h1-6,22H,(H2,20,21,23) |
| InChIKey | YNYHPPDKOFJEOD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.68 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|